C27H44O6 — CID 72605583
[2-[2-(4a-methyl-8-methylidene-1,2,3,4,5,6,7,8a-octahydronaphthalen-2-yl)propan-2-yloxy]-4,5-dihydroxy-6-methyloxan-3-yl] 3-methylpent-2-enoate (PubChem CID 72605583) has the molecular formula C27H44O6 and a molecular weight of 464.64 g/mol. Its IUPAC name is [2-[2-(4a-methyl-8-methylidene-1,2,3,4,5,6,7,8a-octahydronaphthalen-2-yl)propan-2-yloxy]-4,5-dihydroxy-6-methyloxan-3-yl] 3-methylpent-2-enoate.
| Compound Name | [2-[2-(4a-methyl-8-methylidene-1,2,3,4,5,6,7,8a-octahydronaphthalen-2-yl)propan-2-yloxy]-4,5-dihydroxy-6-methyloxan-3-yl] 3-methylpent-2-enoate |
|---|---|
| PubChem CID | 72605583 |
| Molecular Formula | C27H44O6 |
| Molecular Weight | 464.64 g/mol |
| Exact Mass | 464.31 |
| IUPAC Name | [2-[2-(4a-methyl-8-methylidene-1,2,3,4,5,6,7,8a-octahydronaphthalen-2-yl)propan-2-yloxy]-4,5-dihydroxy-6-methyloxan-3-yl] 3-methylpent-2-enoate |
| SMILES | C=C1CCCC2(C)CCC(C(C)(C)OC3OC(C)C(O)C(O)C3OC(=O)C=C(C)CC)CC12 |
| InChI | InChI=1S/C27H44O6/c1-8-16(2)14-21(28)32-24-23(30)22(29)18(4)31-25(24)33-26(5,6)19-11-13-27(7)12-9-10-17(3)20(27)15-19/h14,18-20,22-25,29-30H,3,8-13,15H2,1-2,4-7H3 |
| InChIKey | RPHPEAFYXNTSRD-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.64 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|