C26H42O6 — CID 75212563
[2-[2-(4a-methyl-8-methylidene-1,2,3,4,5,6,7,8a-octahydronaphthalen-2-yl)propan-2-yloxy]-4,5-dihydroxy-6-methyloxan-3-yl] 2-methylbut-2-enoate (PubChem CID 75212563) has the molecular formula C26H42O6 and a molecular weight of 450.62 g/mol. Its IUPAC name is [2-[2-(4a-methyl-8-methylidene-1,2,3,4,5,6,7,8a-octahydronaphthalen-2-yl)propan-2-yloxy]-4,5-dihydroxy-6-methyloxan-3-yl] 2-methylbut-2-enoate.
| Compound Name | [2-[2-(4a-methyl-8-methylidene-1,2,3,4,5,6,7,8a-octahydronaphthalen-2-yl)propan-2-yloxy]-4,5-dihydroxy-6-methyloxan-3-yl] 2-methylbut-2-enoate |
|---|---|
| PubChem CID | 75212563 |
| Molecular Formula | C26H42O6 |
| Molecular Weight | 450.62 g/mol |
| Exact Mass | 450.30 |
| IUPAC Name | [2-[2-(4a-methyl-8-methylidene-1,2,3,4,5,6,7,8a-octahydronaphthalen-2-yl)propan-2-yloxy]-4,5-dihydroxy-6-methyloxan-3-yl] 2-methylbut-2-enoate |
| SMILES | C=C1CCCC2(C)CCC(C(C)(C)OC3OC(C)C(O)C(O)C3OC(=O)C(C)=CC)CC12 |
| InChI | InChI=1S/C26H42O6/c1-8-15(2)23(29)31-22-21(28)20(27)17(4)30-24(22)32-25(5,6)18-11-13-26(7)12-9-10-16(3)19(26)14-18/h8,17-22,24,27-28H,3,9-14H2,1-2,4-7H3 |
| InChIKey | QKRNXYDUTFTSBG-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.62 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|