C26H42O7 — CID 51683816
[(2R,3S,4R,5S,6S)-2-[[(1R,4S,4aS,8aS)-4-hydroxy-1,4a-dimethyl-7-propan-2-yl-2,3,4,5,8,8a-hexahydronaphthalen-1-yl]oxy]-4,5-dihydroxy-6-methyloxan-3-yl] (Z)-2-methylbut-2-enoate (PubChem CID 51683816) has the molecular formula C26H42O7 and a molecular weight of 466.62 g/mol. Its IUPAC name is [(2R,3S,4R,5S,6S)-2-[[(1R,4S,4aS,8aS)-4-hydroxy-1,4a-dimethyl-7-propan-2-yl-2,3,4,5,8,8a-hexahydronaphthalen-1-yl]oxy]-4,5-dihydroxy-6-methyloxan-3-yl] (Z)-2-methylbut-2-enoate.
| Compound Name | [(2R,3S,4R,5S,6S)-2-[[(1R,4S,4aS,8aS)-4-hydroxy-1,4a-dimethyl-7-propan-2-yl-2,3,4,5,8,8a-hexahydronaphthalen-1-yl]oxy]-4,5-dihydroxy-6-methyloxan-3-yl] (Z)-2-methylbut-2-enoate |
|---|---|
| PubChem CID | 51683816 |
| Molecular Formula | C26H42O7 |
| Molecular Weight | 466.62 g/mol |
| Exact Mass | 466.29 |
| IUPAC Name | [(2R,3S,4R,5S,6S)-2-[[(1R,4S,4aS,8aS)-4-hydroxy-1,4a-dimethyl-7-propan-2-yl-2,3,4,5,8,8a-hexahydronaphthalen-1-yl]oxy]-4,5-dihydroxy-6-methyloxan-3-yl] (Z)-2-methylbut-2-enoate |
| SMILES | C/C=C(/C)C(=O)O[C@@H]1[C@@H](O[C@]2(C)CC[C@H](O)[C@@]3(C)CC=C(C(C)C)C[C@@H]32)O[C@@H](C)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C26H42O7/c1-8-15(4)23(30)32-22-21(29)20(28)16(5)31-24(22)33-26(7)12-10-19(27)25(6)11-9-17(14(2)3)13-18(25)26/h8-9,14,16,18-22,24,27-29H,10-13H2,1-7H3/b15-8-/t16-,18-,19-,20+,21+,22-,24+,25-,26+/m0/s1 |
| InChIKey | FHKILVGZXHQHED-UKVCLHEVSA-N |
| XLogP | 3.26 |
| TPSA | 105.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.62 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|