C17H13ClN2OS — CID 726220
N-[5-[(3-chlorophenyl)methyl]-1,3-thiazol-2-yl]benzamide (PubChem CID 726220) has the molecular formula C17H13ClN2OS and a molecular weight of 328.82 g/mol. Its IUPAC name is N-[5-[(3-chlorophenyl)methyl]-1,3-thiazol-2-yl]benzamide.
| Compound Name | N-[5-[(3-chlorophenyl)methyl]-1,3-thiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 726220 |
| Molecular Formula | C17H13ClN2OS |
| Molecular Weight | 328.82 g/mol |
| Exact Mass | 328.04 |
| IUPAC Name | N-[5-[(3-chlorophenyl)methyl]-1,3-thiazol-2-yl]benzamide |
| SMILES | O=C(Nc1ncc(Cc2cccc(Cl)c2)s1)c1ccccc1 |
| InChI | InChI=1S/C17H13ClN2OS/c18-14-8-4-5-12(9-14)10-15-11-19-17(22-15)20-16(21)13-6-2-1-3-7-13/h1-9,11H,10H2,(H,19,20,21) |
| InChIKey | UWDOLBLSWYKCAF-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.82 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |