C16H12N2O3 — CID 726433
6-(1,3-dioxoinden-2-ylidene)-1-methylpyridine-3-carboxamide (PubChem CID 726433) has the molecular formula C16H12N2O3 and a molecular weight of 280.28 g/mol. Its IUPAC name is 6-(1,3-dioxoinden-2-ylidene)-1-methylpyridine-3-carboxamide.
| Compound Name | 6-(1,3-dioxoinden-2-ylidene)-1-methylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 726433 |
| Molecular Formula | C16H12N2O3 |
| Molecular Weight | 280.28 g/mol |
| Exact Mass | 280.08 |
| IUPAC Name | 6-(1,3-dioxoinden-2-ylidene)-1-methylpyridine-3-carboxamide |
| SMILES | CN1C=C(C(N)=O)C=CC1=C1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C16H12N2O3/c1-18-8-9(16(17)21)6-7-12(18)13-14(19)10-4-2-3-5-11(10)15(13)20/h2-8H,1H3,(H2,17,21) |
| InChIKey | WAQRHXZATNFZQJ-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.28 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_five_one_A(55)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|