C33H29F4N7O4S — CID 72656932
[4-amino-2-[4-[4-[[2-(2,4-difluorophenyl)-2-(1,2,4-triazol-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy]phenyl]piperazin-1-yl]-1,3-thiazol-5-yl]-(2,4-difluorophenyl)methanone (PubChem CID 72656932) has the molecular formula C33H29F4N7O4S and a molecular weight of 695.70 g/mol. Its IUPAC name is [4-amino-2-[4-[4-[[2-(2,4-difluorophenyl)-2-(1,2,4-triazol-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy]phenyl]piperazin-1-yl]-1,3-thiazol-5-yl]-(2,4-difluorophenyl)methanone.
| Compound Name | [4-amino-2-[4-[4-[[2-(2,4-difluorophenyl)-2-(1,2,4-triazol-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy]phenyl]piperazin-1-yl]-1,3-thiazol-5-yl]-(2,4-difluorophenyl)methanone |
|---|---|
| PubChem CID | 72656932 |
| Molecular Formula | C33H29F4N7O4S |
| Molecular Weight | 695.70 g/mol |
| Exact Mass | 695.19 |
| IUPAC Name | [4-amino-2-[4-[4-[[2-(2,4-difluorophenyl)-2-(1,2,4-triazol-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy]phenyl]piperazin-1-yl]-1,3-thiazol-5-yl]-(2,4-difluorophenyl)methanone |
| SMILES | Nc1nc(N2CCN(c3ccc(OCC4COC(Cn5cncn5)(c5ccc(F)cc5F)O4)cc3)CC2)sc1C(=O)c1ccc(F)cc1F |
| InChI | InChI=1S/C33H29F4N7O4S/c34-20-1-7-25(27(36)13-20)29(45)30-31(38)41-32(49-30)43-11-9-42(10-12-43)22-3-5-23(6-4-22)46-15-24-16-47-33(48-24,17-44-19-39-18-40-44)26-8-2-21(35)14-28(26)37/h1-8,13-14,18-19,24H,9-12,15-17,38H2 |
| InChIKey | ZKVNMOHFYBLADC-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 120.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 695.70 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|