C14H23N — CID 72660192
N-butyl-2-methyl-6-methylideneocta-2,7-dien-1-imine (PubChem CID 72660192) has the molecular formula C14H23N and a molecular weight of 205.34 g/mol. Its IUPAC name is N-butyl-2-methyl-6-methylideneocta-2,7-dien-1-imine.
| Compound Name | N-butyl-2-methyl-6-methylideneocta-2,7-dien-1-imine |
|---|---|
| PubChem CID | 72660192 |
| Molecular Formula | C14H23N |
| Molecular Weight | 205.34 g/mol |
| Exact Mass | 205.18 |
| IUPAC Name | N-butyl-2-methyl-6-methylideneocta-2,7-dien-1-imine |
| SMILES | C=CC(=C)CCC=C(C)/C=N/CCCC |
| InChI | InChI=1S/C14H23N/c1-5-7-11-15-12-14(4)10-8-9-13(3)6-2/h6,10,12H,2-3,5,7-9,11H2,1,4H3/b14-10?,15-12+ |
| InChIKey | YTUVNONNDKXIBM-ZTYJJYJNSA-N |
| XLogP | 4.33 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.34 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|