C23H21N3O3S — CID 72686560
N-[2-(5-benzylidene-2,4-dioxo-1,3-thiazolidin-3-yl)ethyl]-2-(4-methyl-1H-indol-3-yl)acetamide (PubChem CID 72686560) has the molecular formula C23H21N3O3S and a molecular weight of 419.51 g/mol. Its IUPAC name is N-[2-(5-benzylidene-2,4-dioxo-1,3-thiazolidin-3-yl)ethyl]-2-(4-methyl-1H-indol-3-yl)acetamide.
| Compound Name | N-[2-(5-benzylidene-2,4-dioxo-1,3-thiazolidin-3-yl)ethyl]-2-(4-methyl-1H-indol-3-yl)acetamide |
|---|---|
| PubChem CID | 72686560 |
| Molecular Formula | C23H21N3O3S |
| Molecular Weight | 419.51 g/mol |
| Exact Mass | 419.13 |
| IUPAC Name | N-[2-(5-benzylidene-2,4-dioxo-1,3-thiazolidin-3-yl)ethyl]-2-(4-methyl-1H-indol-3-yl)acetamide |
| SMILES | Cc1cccc2[nH]cc(CC(=O)NCCN3C(=O)SC(=Cc4ccccc4)C3=O)c12 |
| InChI | InChI=1S/C23H21N3O3S/c1-15-6-5-9-18-21(15)17(14-25-18)13-20(27)24-10-11-26-22(28)19(30-23(26)29)12-16-7-3-2-4-8-16/h2-9,12,14,25H,10-11,13H2,1H3,(H,24,27) |
| InChIKey | PTDYFCQZFLQTSV-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 82.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.51 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|