C17H32N2O3 — CID 72690153
tert-butyl N-[2-ethyl-2-(2-methylpent-2-enoylamino)butyl]carbamate (PubChem CID 72690153) has the molecular formula C17H32N2O3 and a molecular weight of 312.45 g/mol. Its IUPAC name is tert-butyl N-[2-ethyl-2-(2-methylpent-2-enoylamino)butyl]carbamate.
| Compound Name | tert-butyl N-[2-ethyl-2-(2-methylpent-2-enoylamino)butyl]carbamate |
|---|---|
| PubChem CID | 72690153 |
| Molecular Formula | C17H32N2O3 |
| Molecular Weight | 312.45 g/mol |
| Exact Mass | 312.24 |
| IUPAC Name | tert-butyl N-[2-ethyl-2-(2-methylpent-2-enoylamino)butyl]carbamate |
| SMILES | CCC=C(C)C(=O)NC(CC)(CC)CNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H32N2O3/c1-8-11-13(4)14(20)19-17(9-2,10-3)12-18-15(21)22-16(5,6)7/h11H,8-10,12H2,1-7H3,(H,18,21)(H,19,20) |
| InChIKey | SGVJVFXMWFXNQP-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.45 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|