C18H32N2O6S2 — CID 59641433
S-[2-(acetylsulfanylmethyl)-2,3-bis[(2-methylpropan-2-yl)oxycarbonylamino]propyl] ethanethioate (PubChem CID 59641433) has the molecular formula C18H32N2O6S2 and a molecular weight of 436.60 g/mol. Its IUPAC name is S-[2-(acetylsulfanylmethyl)-2,3-bis[(2-methylpropan-2-yl)oxycarbonylamino]propyl] ethanethioate.
| Compound Name | S-[2-(acetylsulfanylmethyl)-2,3-bis[(2-methylpropan-2-yl)oxycarbonylamino]propyl] ethanethioate |
|---|---|
| PubChem CID | 59641433 |
| Molecular Formula | C18H32N2O6S2 |
| Molecular Weight | 436.60 g/mol |
| Exact Mass | 436.17 |
| IUPAC Name | S-[2-(acetylsulfanylmethyl)-2,3-bis[(2-methylpropan-2-yl)oxycarbonylamino]propyl] ethanethioate |
| SMILES | CC(=O)SCC(CNC(=O)OC(C)(C)C)(CSC(C)=O)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H32N2O6S2/c1-12(21)27-10-18(11-28-13(2)22,20-15(24)26-17(6,7)8)9-19-14(23)25-16(3,4)5/h9-11H2,1-8H3,(H,19,23)(H,20,24) |
| InChIKey | QXJXSKVAZCEDEC-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.60 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|