C13H17ClN3O3+ — CID 7269116
morpholin-4-ium-4-ylmethyl N-[(Z)-(2-chlorophenyl)methylideneamino]carbamate (PubChem CID 7269116) has the molecular formula C13H17ClN3O3+ and a molecular weight of 298.75 g/mol. Its IUPAC name is morpholin-4-ium-4-ylmethyl N-[(Z)-(2-chlorophenyl)methylideneamino]carbamate.
| Compound Name | morpholin-4-ium-4-ylmethyl N-[(Z)-(2-chlorophenyl)methylideneamino]carbamate |
|---|---|
| PubChem CID | 7269116 |
| Molecular Formula | C13H17ClN3O3+ |
| Molecular Weight | 298.75 g/mol |
| Exact Mass | 298.10 |
| IUPAC Name | morpholin-4-ium-4-ylmethyl N-[(Z)-(2-chlorophenyl)methylideneamino]carbamate |
| SMILES | O=C(N/N=C\c1ccccc1Cl)OC[NH+]1CCOCC1 |
| InChI | InChI=1S/C13H16ClN3O3/c14-12-4-2-1-3-11(12)9-15-16-13(18)20-10-17-5-7-19-8-6-17/h1-4,9H,5-8,10H2,(H,16,18)/p+1/b15-9- |
| InChIKey | PICLQQLMTSOICP-DHDCSXOGSA-O |
| XLogP | 0.27 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.75 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|