C19H31N3O3 — CID 72691658
N-[1-amino-1-[3-(4-tert-butylphenoxy)propoxyimino]-2-methylpropan-2-yl]acetamide (PubChem CID 72691658) has the molecular formula C19H31N3O3 and a molecular weight of 349.48 g/mol. Its IUPAC name is N-[1-amino-1-[3-(4-tert-butylphenoxy)propoxyimino]-2-methylpropan-2-yl]acetamide.
| Compound Name | N-[1-amino-1-[3-(4-tert-butylphenoxy)propoxyimino]-2-methylpropan-2-yl]acetamide |
|---|---|
| PubChem CID | 72691658 |
| Molecular Formula | C19H31N3O3 |
| Molecular Weight | 349.48 g/mol |
| Exact Mass | 349.24 |
| IUPAC Name | N-[1-amino-1-[3-(4-tert-butylphenoxy)propoxyimino]-2-methylpropan-2-yl]acetamide |
| SMILES | CC(=O)NC(C)(C)C(N)=NOCCCOc1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C19H31N3O3/c1-14(23)21-19(5,6)17(20)22-25-13-7-12-24-16-10-8-15(9-11-16)18(2,3)4/h8-11H,7,12-13H2,1-6H3,(H2,20,22)(H,21,23) |
| InChIKey | FDUMRLWPKVWQPZ-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 85.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.48 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|