C17H25NO4 — CID 72694813
(2E,4E,6R)-7-(3,4-dimethoxyphenyl)-1-(ethylamino)hepta-2,4-diene-1,6-diol (PubChem CID 72694813) has the molecular formula C17H25NO4 and a molecular weight of 307.39 g/mol. Its IUPAC name is (2E,4E,6R)-7-(3,4-dimethoxyphenyl)-1-(ethylamino)hepta-2,4-diene-1,6-diol.
| Compound Name | (2E,4E,6R)-7-(3,4-dimethoxyphenyl)-1-(ethylamino)hepta-2,4-diene-1,6-diol |
|---|---|
| PubChem CID | 72694813 |
| Molecular Formula | C17H25NO4 |
| Molecular Weight | 307.39 g/mol |
| Exact Mass | 307.18 |
| IUPAC Name | (2E,4E,6R)-7-(3,4-dimethoxyphenyl)-1-(ethylamino)hepta-2,4-diene-1,6-diol |
| SMILES | CCNC(O)/C=C/C=C/[C@H](O)Cc1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C17H25NO4/c1-4-18-17(20)8-6-5-7-14(19)11-13-9-10-15(21-2)16(12-13)22-3/h5-10,12,14,17-20H,4,11H2,1-3H3/b7-5+,8-6+/t14-,17?/m0/s1 |
| InChIKey | MXLRDEAHZQGWBA-AJXBHJDUSA-N |
| XLogP | 1.65 |
| TPSA | 70.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.39 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|