C24H35NO5 — CID 54564276
14-(3,4-dimethoxyphenyl)-5,12-dihydroxy-N,N-dimethyltetradeca-6,8,10-trienamide (PubChem CID 54564276) has the molecular formula C24H35NO5 and a molecular weight of 417.55 g/mol. Its IUPAC name is 14-(3,4-dimethoxyphenyl)-5,12-dihydroxy-N,N-dimethyltetradeca-6,8,10-trienamide.
| Compound Name | 14-(3,4-dimethoxyphenyl)-5,12-dihydroxy-N,N-dimethyltetradeca-6,8,10-trienamide |
|---|---|
| PubChem CID | 54564276 |
| Molecular Formula | C24H35NO5 |
| Molecular Weight | 417.55 g/mol |
| Exact Mass | 417.25 |
| IUPAC Name | 14-(3,4-dimethoxyphenyl)-5,12-dihydroxy-N,N-dimethyltetradeca-6,8,10-trienamide |
| SMILES | COc1ccc(CCC(O)C=CC=CC=CC(O)CCCC(=O)N(C)C)cc1OC |
| InChI | InChI=1S/C24H35NO5/c1-25(2)24(28)13-9-12-20(26)10-7-5-6-8-11-21(27)16-14-19-15-17-22(29-3)23(18-19)30-4/h5-8,10-11,15,17-18,20-21,26-27H,9,12-14,16H2,1-4H3 |
| InChIKey | ZSSMUNPOOOAJEP-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 79.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.55 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|