C24H35NO6 — CID 88651558
(5E,7Z,9E)-4,11-dihydroxy-15-(3,4,5-trimethoxyphenyl)pentadeca-5,7,9-trienamide (PubChem CID 88651558) has the molecular formula C24H35NO6 and a molecular weight of 433.55 g/mol. Its IUPAC name is (5E,7Z,9E)-4,11-dihydroxy-15-(3,4,5-trimethoxyphenyl)pentadeca-5,7,9-trienamide.
| Compound Name | (5E,7Z,9E)-4,11-dihydroxy-15-(3,4,5-trimethoxyphenyl)pentadeca-5,7,9-trienamide |
|---|---|
| PubChem CID | 88651558 |
| Molecular Formula | C24H35NO6 |
| Molecular Weight | 433.55 g/mol |
| Exact Mass | 433.25 |
| IUPAC Name | (5E,7Z,9E)-4,11-dihydroxy-15-(3,4,5-trimethoxyphenyl)pentadeca-5,7,9-trienamide |
| SMILES | COc1cc(CCCCC(O)/C=C/C=C\C=C\C(O)CCC(N)=O)cc(OC)c1OC |
| InChI | InChI=1S/C24H35NO6/c1-29-21-16-18(17-22(30-2)24(21)31-3)10-8-9-13-19(26)11-6-4-5-7-12-20(27)14-15-23(25)28/h4-7,11-12,16-17,19-20,26-27H,8-10,13-15H2,1-3H3,(H2,25,28)/b5-4-,11-6+,12-7+ |
| InChIKey | BJYCRWJZZLCYPT-DUZYKVORSA-N |
| XLogP | 3.08 |
| TPSA | 111.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.55 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|