C19H12ClNO3 — CID 72697738
6-chloro-2-(5-methyl-3-phenyl-1,2-oxazol-4-yl)chromen-4-one (PubChem CID 72697738) has the molecular formula C19H12ClNO3 and a molecular weight of 337.76 g/mol. Its IUPAC name is 6-chloro-2-(5-methyl-3-phenyl-1,2-oxazol-4-yl)chromen-4-one.
| Compound Name | 6-chloro-2-(5-methyl-3-phenyl-1,2-oxazol-4-yl)chromen-4-one |
|---|---|
| PubChem CID | 72697738 |
| Molecular Formula | C19H12ClNO3 |
| Molecular Weight | 337.76 g/mol |
| Exact Mass | 337.05 |
| IUPAC Name | 6-chloro-2-(5-methyl-3-phenyl-1,2-oxazol-4-yl)chromen-4-one |
| SMILES | Cc1onc(-c2ccccc2)c1-c1cc(=O)c2cc(Cl)ccc2o1 |
| InChI | InChI=1S/C19H12ClNO3/c1-11-18(19(21-24-11)12-5-3-2-4-6-12)17-10-15(22)14-9-13(20)7-8-16(14)23-17/h2-10H,1H3 |
| InChIKey | DLPZLCYZAHLJRY-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 56.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.76 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |