C13H16BClO4 — CID 72698363
3-chloro-4-hydroxy-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzaldehyde (PubChem CID 72698363) has the molecular formula C13H16BClO4 and a molecular weight of 282.53 g/mol. Its IUPAC name is 3-chloro-4-hydroxy-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzaldehyde.
| Compound Name | 3-chloro-4-hydroxy-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzaldehyde |
|---|---|
| PubChem CID | 72698363 |
| Molecular Formula | C13H16BClO4 |
| Molecular Weight | 282.53 g/mol |
| Exact Mass | 282.08 |
| IUPAC Name | 3-chloro-4-hydroxy-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzaldehyde |
| SMILES | CC1(C)OB(c2c(C=O)ccc(O)c2Cl)OC1(C)C |
| InChI | InChI=1S/C13H16BClO4/c1-12(2)13(3,4)19-14(18-12)10-8(7-16)5-6-9(17)11(10)15/h5-7,17H,1-4H3 |
| InChIKey | BQLLQDRMSMOZIG-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.53 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|