C23H27ClN2 — CID 72701717
4-chloro-3-phenyl-N-(2,4,4-trimethylpentan-2-yl)quinolin-2-amine (PubChem CID 72701717) has the molecular formula C23H27ClN2 and a molecular weight of 366.94 g/mol. Its IUPAC name is 4-chloro-3-phenyl-N-(2,4,4-trimethylpentan-2-yl)quinolin-2-amine.
| Compound Name | 4-chloro-3-phenyl-N-(2,4,4-trimethylpentan-2-yl)quinolin-2-amine |
|---|---|
| PubChem CID | 72701717 |
| Molecular Formula | C23H27ClN2 |
| Molecular Weight | 366.94 g/mol |
| Exact Mass | 366.19 |
| IUPAC Name | 4-chloro-3-phenyl-N-(2,4,4-trimethylpentan-2-yl)quinolin-2-amine |
| SMILES | CC(C)(C)CC(C)(C)Nc1nc2ccccc2c(Cl)c1-c1ccccc1 |
| InChI | InChI=1S/C23H27ClN2/c1-22(2,3)15-23(4,5)26-21-19(16-11-7-6-8-12-16)20(24)17-13-9-10-14-18(17)25-21/h6-14H,15H2,1-5H3,(H,25,26) |
| InChIKey | JKHRNXJEYWTJPY-UHFFFAOYSA-N |
| XLogP | 7.18 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.94 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |