C18H35N2O4P — CID 72702507
3-[[1-(cyclohexylamino)-3,3-dimethyl-1-oxohex-5-en-2-yl]amino]propyl-methoxyphosphinic acid (PubChem CID 72702507) has the molecular formula C18H35N2O4P and a molecular weight of 374.46 g/mol. Its IUPAC name is 3-[[1-(cyclohexylamino)-3,3-dimethyl-1-oxohex-5-en-2-yl]amino]propyl-methoxyphosphinic acid.
| Compound Name | 3-[[1-(cyclohexylamino)-3,3-dimethyl-1-oxohex-5-en-2-yl]amino]propyl-methoxyphosphinic acid |
|---|---|
| PubChem CID | 72702507 |
| Molecular Formula | C18H35N2O4P |
| Molecular Weight | 374.46 g/mol |
| Exact Mass | 374.23 |
| IUPAC Name | 3-[[1-(cyclohexylamino)-3,3-dimethyl-1-oxohex-5-en-2-yl]amino]propyl-methoxyphosphinic acid |
| SMILES | C=CCC(C)(C)C(NCCCP(=O)(O)OC)C(=O)NC1CCCCC1 |
| InChI | InChI=1S/C18H35N2O4P/c1-5-12-18(2,3)16(19-13-9-14-25(22,23)24-4)17(21)20-15-10-7-6-8-11-15/h5,15-16,19H,1,6-14H2,2-4H3,(H,20,21)(H,22,23) |
| InChIKey | MBCTXJQZHLCBMU-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.46 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|