C20H17F8N5O — CID 72703394
7-[4-(3,6-difluoro-2-methoxyphenyl)piperidin-1-yl]-3-(2,2,2-trifluoroethyl)-8-(trifluoromethyl)-[1,2,4]triazolo[4,3-b]pyridazine (PubChem CID 72703394) has the molecular formula C20H17F8N5O and a molecular weight of 495.37 g/mol. Its IUPAC name is 7-[4-(3,6-difluoro-2-methoxyphenyl)piperidin-1-yl]-3-(2,2,2-trifluoroethyl)-8-(trifluoromethyl)-[1,2,4]triazolo[4,3-b]pyridazine.
| Compound Name | 7-[4-(3,6-difluoro-2-methoxyphenyl)piperidin-1-yl]-3-(2,2,2-trifluoroethyl)-8-(trifluoromethyl)-[1,2,4]triazolo[4,3-b]pyridazine |
|---|---|
| PubChem CID | 72703394 |
| Molecular Formula | C20H17F8N5O |
| Molecular Weight | 495.37 g/mol |
| Exact Mass | 495.13 |
| IUPAC Name | 7-[4-(3,6-difluoro-2-methoxyphenyl)piperidin-1-yl]-3-(2,2,2-trifluoroethyl)-8-(trifluoromethyl)-[1,2,4]triazolo[4,3-b]pyridazine |
| SMILES | COc1c(F)ccc(F)c1C1CCN(c2cnn3c(CC(F)(F)F)nnc3c2C(F)(F)F)CC1 |
| InChI | InChI=1S/C20H17F8N5O/c1-34-17-12(22)3-2-11(21)15(17)10-4-6-32(7-5-10)13-9-29-33-14(8-19(23,24)25)30-31-18(33)16(13)20(26,27)28/h2-3,9-10H,4-8H2,1H3 |
| InChIKey | OHDKBAJDMFXWTR-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 55.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.37 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |