C20H21ClF3N5O2 — CID 118108257
8-chloro-7-[4-(2,5-dimethoxyphenyl)piperidin-1-yl]-3-(2,2,2-trifluoroethyl)-[1,2,4]triazolo[4,3-b]pyridazine (PubChem CID 118108257) has the molecular formula C20H21ClF3N5O2 and a molecular weight of 455.87 g/mol. Its IUPAC name is 8-chloro-7-[4-(2,5-dimethoxyphenyl)piperidin-1-yl]-3-(2,2,2-trifluoroethyl)-[1,2,4]triazolo[4,3-b]pyridazine.
| Compound Name | 8-chloro-7-[4-(2,5-dimethoxyphenyl)piperidin-1-yl]-3-(2,2,2-trifluoroethyl)-[1,2,4]triazolo[4,3-b]pyridazine |
|---|---|
| PubChem CID | 118108257 |
| Molecular Formula | C20H21ClF3N5O2 |
| Molecular Weight | 455.87 g/mol |
| Exact Mass | 455.13 |
| IUPAC Name | 8-chloro-7-[4-(2,5-dimethoxyphenyl)piperidin-1-yl]-3-(2,2,2-trifluoroethyl)-[1,2,4]triazolo[4,3-b]pyridazine |
| SMILES | COc1ccc(OC)c(C2CCN(c3cnn4c(CC(F)(F)F)nnc4c3Cl)CC2)c1 |
| InChI | InChI=1S/C20H21ClF3N5O2/c1-30-13-3-4-16(31-2)14(9-13)12-5-7-28(8-6-12)15-11-25-29-17(10-20(22,23)24)26-27-19(29)18(15)21/h3-4,9,11-12H,5-8,10H2,1-2H3 |
| InChIKey | OHFCZKSMGLMXPK-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 64.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.87 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |