C15H13NO4 — CID 72703677
(3S,4S)-3,4-dihydroxy-4-(4-hydroxyphenyl)-1,3-dihydroquinolin-2-one (PubChem CID 72703677) has the molecular formula C15H13NO4 and a molecular weight of 271.27 g/mol. Its IUPAC name is (3S,4S)-3,4-dihydroxy-4-(4-hydroxyphenyl)-1,3-dihydroquinolin-2-one.
| Compound Name | (3S,4S)-3,4-dihydroxy-4-(4-hydroxyphenyl)-1,3-dihydroquinolin-2-one |
|---|---|
| PubChem CID | 72703677 |
| Molecular Formula | C15H13NO4 |
| Molecular Weight | 271.27 g/mol |
| Exact Mass | 271.08 |
| IUPAC Name | (3S,4S)-3,4-dihydroxy-4-(4-hydroxyphenyl)-1,3-dihydroquinolin-2-one |
| SMILES | O=C1Nc2ccccc2[C@@](O)(c2ccc(O)cc2)[C@@H]1O |
| InChI | InChI=1S/C15H13NO4/c17-10-7-5-9(6-8-10)15(20)11-3-1-2-4-12(11)16-14(19)13(15)18/h1-8,13,17-18,20H,(H,16,19)/t13-,15+/m1/s1 |
| InChIKey | KCCQWQGKTHFIKZ-HIFRSBDPSA-N |
| XLogP | 0.94 |
| TPSA | 89.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.27 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |