C30H44N2O6S — CID 72709090
[(1S,2R,3S,4S,6R,7R,8R,14R)-4-ethenyl-3-hydroxy-2,4,7,14-tetramethyl-9-oxo-6-tricyclo[5.4.3.01,8]tetradecanyl] 2-[2-[methyl-[2-(methylamino)ethyl]amino]-3,4-dioxocyclobuten-1-yl]sulfanylacetate (PubChem CID 72709090) has the molecular formula C30H44N2O6S and a molecular weight of 560.76 g/mol. Its IUPAC name is [(1S,2R,3S,4S,6R,7R,8R,14R)-4-ethenyl-3-hydroxy-2,4,7,14-tetramethyl-9-oxo-6-tricyclo[5.4.3.01,8]tetradecanyl] 2-[2-[methyl-[2-(methylamino)ethyl]amino]-3,4-dioxocyclobuten-1-yl]sulfanylacetate.
| Compound Name | [(1S,2R,3S,4S,6R,7R,8R,14R)-4-ethenyl-3-hydroxy-2,4,7,14-tetramethyl-9-oxo-6-tricyclo[5.4.3.01,8]tetradecanyl] 2-[2-[methyl-[2-(methylamino)ethyl]amino]-3,4-dioxocyclobuten-1-yl]sulfanylacetate |
|---|---|
| PubChem CID | 72709090 |
| Molecular Formula | C30H44N2O6S |
| Molecular Weight | 560.76 g/mol |
| Exact Mass | 560.29 |
| IUPAC Name | [(1S,2R,3S,4S,6R,7R,8R,14R)-4-ethenyl-3-hydroxy-2,4,7,14-tetramethyl-9-oxo-6-tricyclo[5.4.3.01,8]tetradecanyl] 2-[2-[methyl-[2-(methylamino)ethyl]amino]-3,4-dioxocyclobuten-1-yl]sulfanylacetate |
| SMILES | C=C[C@]1(C)C[C@@H](OC(=O)CSc2c(N(C)CCNC)c(=O)c2=O)[C@]2(C)[C@H](C)CC[C@]3(CCC(=O)[C@H]32)[C@@H](C)[C@@H]1O |
| InChI | InChI=1S/C30H44N2O6S/c1-8-28(4)15-20(38-21(34)16-39-25-22(23(35)24(25)36)32(7)14-13-31-6)29(5)17(2)9-11-30(18(3)27(28)37)12-10-19(33)26(29)30/h8,17-18,20,26-27,31,37H,1,9-16H2,2-7H3/t17-,18+,20-,26+,27+,28-,29+,30+/m1/s1 |
| InChIKey | WDNBZXXOFLGQET-AGRYBOGKSA-N |
| XLogP | 2.94 |
| TPSA | 113.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.76 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|