C12H21NO — CID 72710171
2-[2-[(1S)-2,2,3-trimethylcyclopentyl]ethoxy]acetonitrile (PubChem CID 72710171) has the molecular formula C12H21NO and a molecular weight of 195.31 g/mol. Its IUPAC name is 2-[2-[(1S)-2,2,3-trimethylcyclopentyl]ethoxy]acetonitrile.
| Compound Name | 2-[2-[(1S)-2,2,3-trimethylcyclopentyl]ethoxy]acetonitrile |
|---|---|
| PubChem CID | 72710171 |
| Molecular Formula | C12H21NO |
| Molecular Weight | 195.31 g/mol |
| Exact Mass | 195.16 |
| IUPAC Name | 2-[2-[(1S)-2,2,3-trimethylcyclopentyl]ethoxy]acetonitrile |
| SMILES | CC1CC[C@@H](CCOCC#N)C1(C)C |
| InChI | InChI=1S/C12H21NO/c1-10-4-5-11(12(10,2)3)6-8-14-9-7-13/h10-11H,4-6,8-9H2,1-3H3/t10?,11-/m0/s1 |
| InChIKey | JESIDIAZDBCBEL-DTIOYNMSSA-N |
| XLogP | 2.99 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.31 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|