C31H54O5S2Si — CID 72713815
(2S,3R)-4-[tert-butyl(dimethyl)silyl]oxy-3-[(4S,6R)-2,2-diethyl-6-(hydroxymethyl)-1,3-dioxan-4-yl]-1-[2-(2-phenylethyl)-1,3-dithian-2-yl]butan-2-ol (PubChem CID 72713815) has the molecular formula C31H54O5S2Si and a molecular weight of 598.99 g/mol. Its IUPAC name is (2S,3R)-4-[tert-butyl(dimethyl)silyl]oxy-3-[(4S,6R)-2,2-diethyl-6-(hydroxymethyl)-1,3-dioxan-4-yl]-1-[2-(2-phenylethyl)-1,3-dithian-2-yl]butan-2-ol.
| Compound Name | (2S,3R)-4-[tert-butyl(dimethyl)silyl]oxy-3-[(4S,6R)-2,2-diethyl-6-(hydroxymethyl)-1,3-dioxan-4-yl]-1-[2-(2-phenylethyl)-1,3-dithian-2-yl]butan-2-ol |
|---|---|
| PubChem CID | 72713815 |
| Molecular Formula | C31H54O5S2Si |
| Molecular Weight | 598.99 g/mol |
| Exact Mass | 598.32 |
| IUPAC Name | (2S,3R)-4-[tert-butyl(dimethyl)silyl]oxy-3-[(4S,6R)-2,2-diethyl-6-(hydroxymethyl)-1,3-dioxan-4-yl]-1-[2-(2-phenylethyl)-1,3-dithian-2-yl]butan-2-ol |
| SMILES | CCC1(CC)O[C@@H](CO)C[C@@H]([C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O)CC2(CCc3ccccc3)SCCCS2)O1 |
| InChI | InChI=1S/C31H54O5S2Si/c1-8-30(9-2)35-25(22-32)20-28(36-30)26(23-34-39(6,7)29(3,4)5)27(33)21-31(37-18-13-19-38-31)17-16-24-14-11-10-12-15-24/h10-12,14-15,25-28,32-33H,8-9,13,16-23H2,1-7H3/t25-,26-,27+,28+/m1/s1 |
| InChIKey | KNHFMESWOKHDSO-VIJSPRBVSA-N |
| XLogP | 7.26 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.99 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|