C40H56 — CID 72716033
1,3,3-trimethyl-2-[(1E,3E,7E,17E)-3,7,12,16-tetramethyl-18-(2,6,6-trimethylcyclohexen-1-yl)octadeca-1,3,5,7,17-pentaen-10,14-diynyl]cyclohexene (PubChem CID 72716033) has the molecular formula C40H56 and a molecular weight of 536.89 g/mol. Its IUPAC name is 1,3,3-trimethyl-2-[(1E,3E,7E,17E)-3,7,12,16-tetramethyl-18-(2,6,6-trimethylcyclohexen-1-yl)octadeca-1,3,5,7,17-pentaen-10,14-diynyl]cyclohexene.
| Compound Name | 1,3,3-trimethyl-2-[(1E,3E,7E,17E)-3,7,12,16-tetramethyl-18-(2,6,6-trimethylcyclohexen-1-yl)octadeca-1,3,5,7,17-pentaen-10,14-diynyl]cyclohexene |
|---|---|
| PubChem CID | 72716033 |
| Molecular Formula | C40H56 |
| Molecular Weight | 536.89 g/mol |
| Exact Mass | 536.44 |
| IUPAC Name | 1,3,3-trimethyl-2-[(1E,3E,7E,17E)-3,7,12,16-tetramethyl-18-(2,6,6-trimethylcyclohexen-1-yl)octadeca-1,3,5,7,17-pentaen-10,14-diynyl]cyclohexene |
| SMILES | CC1=C(/C=C/C(C)=C/C=C/C(C)=C/CC#CC(C)CC#CC(C)/C=C/C2=C(C)CCCC2(C)C)C(C)(C)CCC1 |
| InChI | InChI=1S/C40H56/c1-31(19-13-21-33(3)25-27-37-35(5)23-15-29-39(37,7)8)17-11-12-18-32(2)20-14-22-34(4)26-28-38-36(6)24-16-30-40(38,9)10/h13,17,19,21,25-28,32,34H,11,15-16,20,23-24,29-30H2,1-10H3/b19-13?,27-25+,28-26+,31-17+,33-21+ |
| InChIKey | DXUMREGRCCBREA-PFYKSVQESA-N |
| XLogP | 11.66 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.89 |
| LogP ≤ 5 | 11.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|