C20H24F2N2O3 — CID 72719775
N'-(2,4-difluorophenyl)-N-[(2-methoxy-2-adamantyl)methyl]oxamide (PubChem CID 72719775) has the molecular formula C20H24F2N2O3 and a molecular weight of 378.42 g/mol. Its IUPAC name is N'-(2,4-difluorophenyl)-N-[(2-methoxy-2-adamantyl)methyl]oxamide.
| Compound Name | N'-(2,4-difluorophenyl)-N-[(2-methoxy-2-adamantyl)methyl]oxamide |
|---|---|
| PubChem CID | 72719775 |
| Molecular Formula | C20H24F2N2O3 |
| Molecular Weight | 378.42 g/mol |
| Exact Mass | 378.18 |
| IUPAC Name | N'-(2,4-difluorophenyl)-N-[(2-methoxy-2-adamantyl)methyl]oxamide |
| SMILES | COC1(CNC(=O)C(=O)Nc2ccc(F)cc2F)C2CC3CC(C2)CC1C3 |
| InChI | InChI=1S/C20H24F2N2O3/c1-27-20(13-5-11-4-12(7-13)8-14(20)6-11)10-23-18(25)19(26)24-17-3-2-15(21)9-16(17)22/h2-3,9,11-14H,4-8,10H2,1H3,(H,23,25)(H,24,26) |
| InChIKey | UMSUNOSGNLXHKH-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.42 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|