C15H14IN3 — CID 72720802
4-(6-(131I)iodoimidazo[1,2-a]pyridin-2-yl)-N,N-dimethyl(131I)aniline (PubChem CID 72720802) has the molecular formula C15H14IN3 and a molecular weight of 367.20 g/mol. Its IUPAC name is 4-(6-(131I)iodoimidazo[1,2-a]pyridin-2-yl)-N,N-dimethyl(131I)aniline.
| Compound Name | 4-(6-(131I)iodoimidazo[1,2-a]pyridin-2-yl)-N,N-dimethyl(131I)aniline |
|---|---|
| PubChem CID | 72720802 |
| Molecular Formula | C15H14IN3 |
| Molecular Weight | 367.20 g/mol |
| Exact Mass | 367.02 |
| IUPAC Name | 4-(6-(131I)iodoimidazo[1,2-a]pyridin-2-yl)-N,N-dimethyl(131I)aniline |
| SMILES | CN(C)c1ccc(-c2cn3cc([131I])ccc3n2)cc1 |
| InChI | InChI=1S/C15H14IN3/c1-18(2)13-6-3-11(4-7-13)14-10-19-9-12(16)5-8-15(19)17-14/h3-10H,1-2H3/i16+4 |
| InChIKey | GUJHUHNUHJMRII-SZTGYKDWSA-N |
| XLogP | 3.67 |
| TPSA | 20.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.20 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|