C20H21N3O2S — CID 72721841
8-(1-(111C)methylpiperidin-4-yl)-3-pyridin-2-ylsulfonylquinoline (PubChem CID 72721841) has the molecular formula C20H21N3O2S and a molecular weight of 366.47 g/mol. Its IUPAC name is 8-(1-(111C)methylpiperidin-4-yl)-3-pyridin-2-ylsulfonylquinoline.
| Compound Name | 8-(1-(111C)methylpiperidin-4-yl)-3-pyridin-2-ylsulfonylquinoline |
|---|---|
| PubChem CID | 72721841 |
| Molecular Formula | C20H21N3O2S |
| Molecular Weight | 366.47 g/mol |
| Exact Mass | 366.15 |
| IUPAC Name | 8-(1-(111C)methylpiperidin-4-yl)-3-pyridin-2-ylsulfonylquinoline |
| SMILES | [11CH3]N1CCC(c2cccc3cc(S(=O)(=O)c4ccccn4)cnc23)CC1 |
| InChI | InChI=1S/C20H21N3O2S/c1-23-11-8-15(9-12-23)18-6-4-5-16-13-17(14-22-20(16)18)26(24,25)19-7-2-3-10-21-19/h2-7,10,13-15H,8-9,11-12H2,1H3/i1-1 |
| InChIKey | CNJLQPMEVJPMIO-BJUDXGSMSA-N |
| XLogP | 3.27 |
| TPSA | 63.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.47 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |