C14H20N2O4S — CID 7272191
(1S,2R,3R,4R)-1-[(2S)-5-(4-methylphenyl)-2,3-dihydro-1,3,4-thiadiazol-2-yl]pentane-1,2,3,4-tetrol (PubChem CID 7272191) has the molecular formula C14H20N2O4S and a molecular weight of 312.39 g/mol. Its IUPAC name is (1S,2R,3R,4R)-1-[(2S)-5-(4-methylphenyl)-2,3-dihydro-1,3,4-thiadiazol-2-yl]pentane-1,2,3,4-tetrol.
| Compound Name | (1S,2R,3R,4R)-1-[(2S)-5-(4-methylphenyl)-2,3-dihydro-1,3,4-thiadiazol-2-yl]pentane-1,2,3,4-tetrol |
|---|---|
| PubChem CID | 7272191 |
| Molecular Formula | C14H20N2O4S |
| Molecular Weight | 312.39 g/mol |
| Exact Mass | 312.11 |
| IUPAC Name | (1S,2R,3R,4R)-1-[(2S)-5-(4-methylphenyl)-2,3-dihydro-1,3,4-thiadiazol-2-yl]pentane-1,2,3,4-tetrol |
| SMILES | Cc1ccc(C2=NN[C@H]([C@@H](O)[C@H](O)[C@H](O)[C@@H](C)O)S2)cc1 |
| InChI | InChI=1S/C14H20N2O4S/c1-7-3-5-9(6-4-7)13-15-16-14(21-13)12(20)11(19)10(18)8(2)17/h3-6,8,10-12,14,16-20H,1-2H3/t8-,10-,11-,12+,14+/m1/s1 |
| InChIKey | GODHYXNVUBFUCZ-HSZBIYQXSA-N |
| XLogP | -0.22 |
| TPSA | 105.31 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.39 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |