C16H24N2O4S — CID 51420708
(2R,3R,4R)-2,3-dimethyl-4-[(2R)-5-(4-methylphenyl)-2,3-dihydro-1,3,4-thiadiazol-2-yl]pentane-1,2,3,4-tetrol (PubChem CID 51420708) has the molecular formula C16H24N2O4S and a molecular weight of 340.45 g/mol. Its IUPAC name is (2R,3R,4R)-2,3-dimethyl-4-[(2R)-5-(4-methylphenyl)-2,3-dihydro-1,3,4-thiadiazol-2-yl]pentane-1,2,3,4-tetrol.
| Compound Name | (2R,3R,4R)-2,3-dimethyl-4-[(2R)-5-(4-methylphenyl)-2,3-dihydro-1,3,4-thiadiazol-2-yl]pentane-1,2,3,4-tetrol |
|---|---|
| PubChem CID | 51420708 |
| Molecular Formula | C16H24N2O4S |
| Molecular Weight | 340.45 g/mol |
| Exact Mass | 340.15 |
| IUPAC Name | (2R,3R,4R)-2,3-dimethyl-4-[(2R)-5-(4-methylphenyl)-2,3-dihydro-1,3,4-thiadiazol-2-yl]pentane-1,2,3,4-tetrol |
| SMILES | Cc1ccc(C2=NN[C@@H]([C@](C)(O)[C@](C)(O)[C@](C)(O)CO)S2)cc1 |
| InChI | InChI=1S/C16H24N2O4S/c1-10-5-7-11(8-6-10)12-17-18-13(23-12)15(3,21)16(4,22)14(2,20)9-19/h5-8,13,18-22H,9H2,1-4H3/t13-,14-,15+,16-/m1/s1 |
| InChIKey | UJFQBJKCAWXHKU-LVQVYYBASA-N |
| XLogP | 0.56 |
| TPSA | 105.31 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.45 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |