C14H16ClN3O6 — CID 72722554
(2R,3R,4S,5S,6R)-2-[[5-(3-chlorophenyl)-1,3,4-oxadiazol-2-yl]amino]-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 72722554) has the molecular formula C14H16ClN3O6 and a molecular weight of 357.75 g/mol. Its IUPAC name is (2R,3R,4S,5S,6R)-2-[[5-(3-chlorophenyl)-1,3,4-oxadiazol-2-yl]amino]-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (2R,3R,4S,5S,6R)-2-[[5-(3-chlorophenyl)-1,3,4-oxadiazol-2-yl]amino]-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 72722554 |
| Molecular Formula | C14H16ClN3O6 |
| Molecular Weight | 357.75 g/mol |
| Exact Mass | 357.07 |
| IUPAC Name | (2R,3R,4S,5S,6R)-2-[[5-(3-chlorophenyl)-1,3,4-oxadiazol-2-yl]amino]-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | OC[C@H]1O[C@@H](Nc2nnc(-c3cccc(Cl)c3)o2)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C14H16ClN3O6/c15-7-3-1-2-6(4-7)12-17-18-14(24-12)16-13-11(22)10(21)9(20)8(5-19)23-13/h1-4,8-11,13,19-22H,5H2,(H,16,18)/t8-,9-,10+,11-,13-/m1/s1 |
| InChIKey | ONJKBGQZXHSYQE-BZNQNGANSA-N |
| XLogP | -0.40 |
| TPSA | 141.10 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.75 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |