C23H21NO5 — CID 72723115
ethyl 2-[(2,5-dioxo-1-phenylpyrrol-3-yl)methyl]-3-(4-methylphenyl)-3-oxopropanoate (PubChem CID 72723115) has the molecular formula C23H21NO5 and a molecular weight of 391.42 g/mol. Its IUPAC name is ethyl 2-[(2,5-dioxo-1-phenylpyrrol-3-yl)methyl]-3-(4-methylphenyl)-3-oxopropanoate.
| Compound Name | ethyl 2-[(2,5-dioxo-1-phenylpyrrol-3-yl)methyl]-3-(4-methylphenyl)-3-oxopropanoate |
|---|---|
| PubChem CID | 72723115 |
| Molecular Formula | C23H21NO5 |
| Molecular Weight | 391.42 g/mol |
| Exact Mass | 391.14 |
| IUPAC Name | ethyl 2-[(2,5-dioxo-1-phenylpyrrol-3-yl)methyl]-3-(4-methylphenyl)-3-oxopropanoate |
| SMILES | CCOC(=O)C(CC1=CC(=O)N(c2ccccc2)C1=O)C(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C23H21NO5/c1-3-29-23(28)19(21(26)16-11-9-15(2)10-12-16)13-17-14-20(25)24(22(17)27)18-7-5-4-6-8-18/h4-12,14,19H,3,13H2,1-2H3 |
| InChIKey | GEIOUUZQBOAZTH-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.42 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|