C43H67BN2O12 — CID 72724577
methyl 4-[5,11-diethyl-2,2-bis[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]-4,6,10,12-tetramethyl-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaen-8-yl]benzoate (PubChem CID 72724577) has the molecular formula C43H67BN2O12 and a molecular weight of 814.82 g/mol. Its IUPAC name is methyl 4-[5,11-diethyl-2,2-bis[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]-4,6,10,12-tetramethyl-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaen-8-yl]benzoate.
| Compound Name | methyl 4-[5,11-diethyl-2,2-bis[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]-4,6,10,12-tetramethyl-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaen-8-yl]benzoate |
|---|---|
| PubChem CID | 72724577 |
| Molecular Formula | C43H67BN2O12 |
| Molecular Weight | 814.82 g/mol |
| Exact Mass | 814.48 |
| IUPAC Name | methyl 4-[5,11-diethyl-2,2-bis[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]-4,6,10,12-tetramethyl-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaen-8-yl]benzoate |
| SMILES | CCC1=C(C)C2=C(c3ccc(C(=O)OC)cc3)c3c(C)c(CC)c(C)n3[B-](OCCOCCOCCOCCOC)(OCCOCCOCCOCCOC)[N+]2=C1C |
| InChI | InChI=1S/C43H67BN2O12/c1-10-38-32(3)41-40(36-12-14-37(15-13-36)43(47)50-9)42-33(4)39(11-2)35(6)46(42)44(45(41)34(38)5,57-30-28-55-26-24-53-22-20-51-18-16-48-7)58-31-29-56-27-25-54-23-21-52-19-17-49-8/h12-15H,10-11,16-31H2,1-9H3 |
| InChIKey | GDHWUUZBFZXPST-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 126.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 58 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 814.82 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|