C21H19BF2I2N2O2 — CID 73350710
methyl 4-(2,2-difluoro-5,11-diiodo-4,6,10,12-tetramethyl-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaen-8-yl)benzoate (PubChem CID 73350710) has the molecular formula C21H19BF2I2N2O2 and a molecular weight of 634.01 g/mol. Its IUPAC name is methyl 4-(2,2-difluoro-5,11-diiodo-4,6,10,12-tetramethyl-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaen-8-yl)benzoate.
| Compound Name | methyl 4-(2,2-difluoro-5,11-diiodo-4,6,10,12-tetramethyl-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaen-8-yl)benzoate |
|---|---|
| PubChem CID | 73350710 |
| Molecular Formula | C21H19BF2I2N2O2 |
| Molecular Weight | 634.01 g/mol |
| Exact Mass | 633.96 |
| IUPAC Name | methyl 4-(2,2-difluoro-5,11-diiodo-4,6,10,12-tetramethyl-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaen-8-yl)benzoate |
| SMILES | COC(=O)c1ccc(C2=C3C(C)=C(I)C(C)=[N+]3[B-](F)(F)n3c(C)c(I)c(C)c32)cc1 |
| InChI | InChI=1S/C21H19BF2I2N2O2/c1-10-17(25)12(3)27-19(10)16(14-6-8-15(9-7-14)21(29)30-5)20-11(2)18(26)13(4)28(20)22(27,23)24/h6-9H,1-5H3 |
| InChIKey | MAECHYIBYYFITK-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 34.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.01 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|