C16H19N5O2S — CID 72725546
2-acetamido-N-(3-piperidin-1-yl-4-pyridinyl)-1,3-thiazole-4-carboxamide (PubChem CID 72725546) has the molecular formula C16H19N5O2S and a molecular weight of 345.43 g/mol. Its IUPAC name is 2-acetamido-N-(3-piperidin-1-yl-4-pyridinyl)-1,3-thiazole-4-carboxamide.
| Compound Name | 2-acetamido-N-(3-piperidin-1-yl-4-pyridinyl)-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 72725546 |
| Molecular Formula | C16H19N5O2S |
| Molecular Weight | 345.43 g/mol |
| Exact Mass | 345.13 |
| IUPAC Name | 2-acetamido-N-(3-piperidin-1-yl-4-pyridinyl)-1,3-thiazole-4-carboxamide |
| SMILES | CC(=O)Nc1nc(C(=O)Nc2ccncc2N2CCCCC2)cs1 |
| InChI | InChI=1S/C16H19N5O2S/c1-11(22)18-16-20-13(10-24-16)15(23)19-12-5-6-17-9-14(12)21-7-3-2-4-8-21/h5-6,9-10H,2-4,7-8H2,1H3,(H,17,19,23)(H,18,20,22) |
| InChIKey | HGGDKROMZVBKPS-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 87.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.43 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |