C24H32O5 — CID 72730086
(3a,9a-dihydroxy-4a,5-dimethyl-3-methylidene-5,6-dihydro-4H-benzo[f][1]benzofuran-6-yl) 6-methylocta-2,4-dienoate (PubChem CID 72730086) has the molecular formula C24H32O5 and a molecular weight of 400.52 g/mol. Its IUPAC name is (3a,9a-dihydroxy-4a,5-dimethyl-3-methylidene-5,6-dihydro-4H-benzo[f][1]benzofuran-6-yl) 6-methylocta-2,4-dienoate.
| Compound Name | (3a,9a-dihydroxy-4a,5-dimethyl-3-methylidene-5,6-dihydro-4H-benzo[f][1]benzofuran-6-yl) 6-methylocta-2,4-dienoate |
|---|---|
| PubChem CID | 72730086 |
| Molecular Formula | C24H32O5 |
| Molecular Weight | 400.52 g/mol |
| Exact Mass | 400.22 |
| IUPAC Name | (3a,9a-dihydroxy-4a,5-dimethyl-3-methylidene-5,6-dihydro-4H-benzo[f][1]benzofuran-6-yl) 6-methylocta-2,4-dienoate |
| SMILES | C=C1COC2(O)C=C3C=CC(OC(=O)C=CC=CC(C)CC)C(C)C3(C)CC12O |
| InChI | InChI=1S/C24H32O5/c1-6-16(2)9-7-8-10-21(25)29-20-12-11-19-13-24(27)23(26,17(3)14-28-24)15-22(19,5)18(20)4/h7-13,16,18,20,26-27H,3,6,14-15H2,1-2,4-5H3 |
| InChIKey | JJQRQIUKYIKXNV-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.52 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|