C31H42O8 — CID 102132913
(13-acetyloxy-4,11-dihydroxy-10,11-dimethyl-7-methylidene-2,5-dioxatetracyclo[8.4.0.01,3.04,8]tetradecan-14-yl) (2E,4E,6E,8E)-8,10-dimethyldodeca-2,4,6,8-tetraenoate (PubChem CID 102132913) has the molecular formula C31H42O8 and a molecular weight of 542.67 g/mol. Its IUPAC name is (13-acetyloxy-4,11-dihydroxy-10,11-dimethyl-7-methylidene-2,5-dioxatetracyclo[8.4.0.01,3.04,8]tetradecan-14-yl) (2E,4E,6E,8E)-8,10-dimethyldodeca-2,4,6,8-tetraenoate.
| Compound Name | (13-acetyloxy-4,11-dihydroxy-10,11-dimethyl-7-methylidene-2,5-dioxatetracyclo[8.4.0.01,3.04,8]tetradecan-14-yl) (2E,4E,6E,8E)-8,10-dimethyldodeca-2,4,6,8-tetraenoate |
|---|---|
| PubChem CID | 102132913 |
| Molecular Formula | C31H42O8 |
| Molecular Weight | 542.67 g/mol |
| Exact Mass | 542.29 |
| IUPAC Name | (13-acetyloxy-4,11-dihydroxy-10,11-dimethyl-7-methylidene-2,5-dioxatetracyclo[8.4.0.01,3.04,8]tetradecan-14-yl) (2E,4E,6E,8E)-8,10-dimethyldodeca-2,4,6,8-tetraenoate |
| SMILES | C=C1COC2(O)C1CC1(C)C(C)(O)CC(OC(C)=O)C(OC(=O)/C=C/C=C/C=C/C(C)=C/C(C)CC)C13OC23 |
| InChI | InChI=1S/C31H42O8/c1-8-19(2)15-20(3)13-11-9-10-12-14-25(33)38-26-24(37-22(5)32)17-29(7,34)28(6)16-23-21(4)18-36-31(23,35)27-30(26,28)39-27/h9-15,19,23-24,26-27,34-35H,4,8,16-18H2,1-3,5-7H3/b10-9+,13-11+,14-12+,20-15+ |
| InChIKey | KKQLODFZPXUVGM-AYYMWXKBSA-N |
| XLogP | 4.08 |
| TPSA | 114.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.67 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|