C25H34O5 — CID 170989736
[(1aS,3S,4aR,5R,8R,8aR)-5-hydroxy-4a,5-dimethyl-2-oxo-3-prop-1-en-2-yl-1a,3,4,6,7,8-hexahydronaphtho[8,8a-b]oxiren-8-yl] (2E,4E,6E)-deca-2,4,6-trienoate (PubChem CID 170989736) has the molecular formula C25H34O5 and a molecular weight of 414.54 g/mol. Its IUPAC name is [(1aS,3S,4aR,5R,8R,8aR)-5-hydroxy-4a,5-dimethyl-2-oxo-3-prop-1-en-2-yl-1a,3,4,6,7,8-hexahydronaphtho[8,8a-b]oxiren-8-yl] (2E,4E,6E)-deca-2,4,6-trienoate.
| Compound Name | [(1aS,3S,4aR,5R,8R,8aR)-5-hydroxy-4a,5-dimethyl-2-oxo-3-prop-1-en-2-yl-1a,3,4,6,7,8-hexahydronaphtho[8,8a-b]oxiren-8-yl] (2E,4E,6E)-deca-2,4,6-trienoate |
|---|---|
| PubChem CID | 170989736 |
| Molecular Formula | C25H34O5 |
| Molecular Weight | 414.54 g/mol |
| Exact Mass | 414.24 |
| IUPAC Name | [(1aS,3S,4aR,5R,8R,8aR)-5-hydroxy-4a,5-dimethyl-2-oxo-3-prop-1-en-2-yl-1a,3,4,6,7,8-hexahydronaphtho[8,8a-b]oxiren-8-yl] (2E,4E,6E)-deca-2,4,6-trienoate |
| SMILES | C=C(C)[C@@H]1C[C@@]2(C)[C@@]3(O[C@@H]3C1=O)[C@H](OC(=O)/C=C/C=C/C=C/CCC)CC[C@@]2(C)O |
| InChI | InChI=1S/C25H34O5/c1-6-7-8-9-10-11-12-13-20(26)29-19-14-15-24(5,28)23(4)16-18(17(2)3)21(27)22-25(19,23)30-22/h8-13,18-19,22,28H,2,6-7,14-16H2,1,3-5H3/b9-8+,11-10+,13-12+/t18-,19+,22+,23+,24+,25+/m0/s1 |
| InChIKey | UIJDIWMSOAFNQJ-SIFNDJMESA-N |
| XLogP | 4.22 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.54 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|