C15H20N3O4+ — CID 7273598
ethyl 2-[[2-[(2S)-3-oxopiperazin-1-ium-2-yl]acetyl]amino]benzoate (PubChem CID 7273598) has the molecular formula C15H20N3O4+ and a molecular weight of 306.34 g/mol. Its IUPAC name is ethyl 2-[[2-[(2S)-3-oxopiperazin-1-ium-2-yl]acetyl]amino]benzoate.
| Compound Name | ethyl 2-[[2-[(2S)-3-oxopiperazin-1-ium-2-yl]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 7273598 |
| Molecular Formula | C15H20N3O4+ |
| Molecular Weight | 306.34 g/mol |
| Exact Mass | 306.14 |
| IUPAC Name | ethyl 2-[[2-[(2S)-3-oxopiperazin-1-ium-2-yl]acetyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccccc1NC(=O)C[C@@H]1[NH2+]CCNC1=O |
| InChI | InChI=1S/C15H19N3O4/c1-2-22-15(21)10-5-3-4-6-11(10)18-13(19)9-12-14(20)17-8-7-16-12/h3-6,12,16H,2,7-9H2,1H3,(H,17,20)(H,18,19)/p+1/t12-/m0/s1 |
| InChIKey | OIPAFJCKSWLIMI-LBPRGKRZSA-O |
| XLogP | -0.75 |
| TPSA | 101.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.34 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |