C13H9NO2S2 — CID 7274345
(1R)-8-oxa-12,16-dithia-14-azatetracyclo[8.7.0.02,7.013,17]heptadeca-2,4,6,10,13(17)-pentaen-15-one (PubChem CID 7274345) has the molecular formula C13H9NO2S2 and a molecular weight of 275.35 g/mol. Its IUPAC name is (1R)-8-oxa-12,16-dithia-14-azatetracyclo[8.7.0.02,7.013,17]heptadeca-2,4,6,10,13(17)-pentaen-15-one.
| Compound Name | (1R)-8-oxa-12,16-dithia-14-azatetracyclo[8.7.0.02,7.013,17]heptadeca-2,4,6,10,13(17)-pentaen-15-one |
|---|---|
| PubChem CID | 7274345 |
| Molecular Formula | C13H9NO2S2 |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.01 |
| IUPAC Name | (1R)-8-oxa-12,16-dithia-14-azatetracyclo[8.7.0.02,7.013,17]heptadeca-2,4,6,10,13(17)-pentaen-15-one |
| SMILES | O=c1[nH]c2c(s1)[C@H]1C(=CS2)COc2ccccc21 |
| InChI | InChI=1S/C13H9NO2S2/c15-13-14-12-11(18-13)10-7(6-17-12)5-16-9-4-2-1-3-8(9)10/h1-4,6,10H,5H2,(H,14,15)/t10-/m0/s1 |
| InChIKey | NHTNNHIEPKETGO-JTQLQIEISA-N |
| XLogP | 2.95 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'} |
|---|