C21H20 — CID 72751281
2,5-dibenzylbicyclo[2.2.1]hepta-2,5-diene (PubChem CID 72751281) has the molecular formula C21H20 and a molecular weight of 272.39 g/mol. Its IUPAC name is 2,5-dibenzylbicyclo[2.2.1]hepta-2,5-diene.
| Compound Name | 2,5-dibenzylbicyclo[2.2.1]hepta-2,5-diene |
|---|---|
| PubChem CID | 72751281 |
| Molecular Formula | C21H20 |
| Molecular Weight | 272.39 g/mol |
| Exact Mass | 272.16 |
| IUPAC Name | 2,5-dibenzylbicyclo[2.2.1]hepta-2,5-diene |
| SMILES | C1=C(Cc2ccccc2)C2C=C(Cc3ccccc3)C1C2 |
| InChI | InChI=1S/C21H20/c1-3-7-16(8-4-1)11-18-13-21-15-20(18)14-19(21)12-17-9-5-2-6-10-17/h1-10,13-14,20-21H,11-12,15H2 |
| InChIKey | NMAAYCBIZZGVPA-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.39 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|