C22H24FNO8 — CID 72758268
2-(1,2-dihydroxyhex-3-enyl)-8-(2-fluorobenzoyl)-9-hydroxy-8-methoxy-3-methyl-1-oxa-7-azaspiro[4.4]non-2-ene-4,6-dione (PubChem CID 72758268) has the molecular formula C22H24FNO8 and a molecular weight of 449.43 g/mol. Its IUPAC name is 2-(1,2-dihydroxyhex-3-enyl)-8-(2-fluorobenzoyl)-9-hydroxy-8-methoxy-3-methyl-1-oxa-7-azaspiro[4.4]non-2-ene-4,6-dione.
| Compound Name | 2-(1,2-dihydroxyhex-3-enyl)-8-(2-fluorobenzoyl)-9-hydroxy-8-methoxy-3-methyl-1-oxa-7-azaspiro[4.4]non-2-ene-4,6-dione |
|---|---|
| PubChem CID | 72758268 |
| Molecular Formula | C22H24FNO8 |
| Molecular Weight | 449.43 g/mol |
| Exact Mass | 449.15 |
| IUPAC Name | 2-(1,2-dihydroxyhex-3-enyl)-8-(2-fluorobenzoyl)-9-hydroxy-8-methoxy-3-methyl-1-oxa-7-azaspiro[4.4]non-2-ene-4,6-dione |
| SMILES | CCC=CC(O)C(O)C1=C(C)C(=O)C2(O1)C(=O)NC(OC)(C(=O)c1ccccc1F)C2O |
| InChI | InChI=1S/C22H24FNO8/c1-4-5-10-14(25)15(26)16-11(2)17(27)21(32-16)19(29)22(31-3,24-20(21)30)18(28)12-8-6-7-9-13(12)23/h5-10,14-15,19,25-26,29H,4H2,1-3H3,(H,24,30) |
| InChIKey | CMCMOKIZWKBEAS-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 142.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.43 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|