C22H23NO10 — CID 44565127
methyl (E,4S,5S)-5-[(5S,8S,9R)-8-benzoyl-9-hydroxy-8-methoxy-3-methyl-4,6-dioxo-1-oxa-7-azaspiro[4.4]non-2-en-2-yl]-4,5-dihydroxypent-2-enoate (PubChem CID 44565127) has the molecular formula C22H23NO10 and a molecular weight of 461.42 g/mol. Its IUPAC name is methyl (E,4S,5S)-5-[(5S,8S,9R)-8-benzoyl-9-hydroxy-8-methoxy-3-methyl-4,6-dioxo-1-oxa-7-azaspiro[4.4]non-2-en-2-yl]-4,5-dihydroxypent-2-enoate.
| Compound Name | methyl (E,4S,5S)-5-[(5S,8S,9R)-8-benzoyl-9-hydroxy-8-methoxy-3-methyl-4,6-dioxo-1-oxa-7-azaspiro[4.4]non-2-en-2-yl]-4,5-dihydroxypent-2-enoate |
|---|---|
| PubChem CID | 44565127 |
| Molecular Formula | C22H23NO10 |
| Molecular Weight | 461.42 g/mol |
| Exact Mass | 461.13 |
| IUPAC Name | methyl (E,4S,5S)-5-[(5S,8S,9R)-8-benzoyl-9-hydroxy-8-methoxy-3-methyl-4,6-dioxo-1-oxa-7-azaspiro[4.4]non-2-en-2-yl]-4,5-dihydroxypent-2-enoate |
| SMILES | COC(=O)/C=C/[C@H](O)[C@H](O)C1=C(C)C(=O)[C@]2(O1)C(=O)N[C@@](OC)(C(=O)c1ccccc1)[C@@H]2O |
| InChI | InChI=1S/C22H23NO10/c1-11-16(15(26)13(24)9-10-14(25)31-2)33-21(17(11)27)19(29)22(32-3,23-20(21)30)18(28)12-7-5-4-6-8-12/h4-10,13,15,19,24,26,29H,1-3H3,(H,23,30)/b10-9+/t13-,15-,19+,21+,22+/m0/s1 |
| InChIKey | ZATGFXDLJXXOBO-LBBGEYLISA-N |
| XLogP | -1.23 |
| TPSA | 168.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.42 |
| LogP ≤ 5 | -1.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|