C34H38N2O6 — CID 72774008
5-[7-[6-(5-oxo-5-piperidin-1-ylpenta-1,3-dienyl)-1,3-benzodioxol-4-yl]-1,3-benzodioxol-5-yl]-1-piperidin-1-ylpent-2-en-1-one (PubChem CID 72774008) has the molecular formula C34H38N2O6 and a molecular weight of 570.69 g/mol. Its IUPAC name is 5-[7-[6-(5-oxo-5-piperidin-1-ylpenta-1,3-dienyl)-1,3-benzodioxol-4-yl]-1,3-benzodioxol-5-yl]-1-piperidin-1-ylpent-2-en-1-one.
| Compound Name | 5-[7-[6-(5-oxo-5-piperidin-1-ylpenta-1,3-dienyl)-1,3-benzodioxol-4-yl]-1,3-benzodioxol-5-yl]-1-piperidin-1-ylpent-2-en-1-one |
|---|---|
| PubChem CID | 72774008 |
| Molecular Formula | C34H38N2O6 |
| Molecular Weight | 570.69 g/mol |
| Exact Mass | 570.27 |
| IUPAC Name | 5-[7-[6-(5-oxo-5-piperidin-1-ylpenta-1,3-dienyl)-1,3-benzodioxol-4-yl]-1,3-benzodioxol-5-yl]-1-piperidin-1-ylpent-2-en-1-one |
| SMILES | O=C(C=CC=Cc1cc2c(c(-c3cc(CCC=CC(=O)N4CCCCC4)cc4c3OCO4)c1)OCO2)N1CCCCC1 |
| InChI | InChI=1S/C34H38N2O6/c37-31(35-15-7-1-8-16-35)13-5-3-11-25-19-27(33-29(21-25)39-23-41-33)28-20-26(22-30-34(28)42-24-40-30)12-4-6-14-32(38)36-17-9-2-10-18-36/h3,5-6,11,13-14,19-22H,1-2,4,7-10,12,15-18,23-24H2 |
| InChIKey | NPXVYHIXYLWTHJ-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 77.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.69 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|