C29H38N2O3 — CID 72782671
3-[6-[N-[(4-cyclohexyl-3-ethylphenyl)methoxy]-C-methylcarbonimidoyl]-3,4-dihydro-1H-isoquinolin-2-yl]propanoic acid (PubChem CID 72782671) has the molecular formula C29H38N2O3 and a molecular weight of 462.63 g/mol. Its IUPAC name is 3-[6-[N-[(4-cyclohexyl-3-ethylphenyl)methoxy]-C-methylcarbonimidoyl]-3,4-dihydro-1H-isoquinolin-2-yl]propanoic acid.
| Compound Name | 3-[6-[N-[(4-cyclohexyl-3-ethylphenyl)methoxy]-C-methylcarbonimidoyl]-3,4-dihydro-1H-isoquinolin-2-yl]propanoic acid |
|---|---|
| PubChem CID | 72782671 |
| Molecular Formula | C29H38N2O3 |
| Molecular Weight | 462.63 g/mol |
| Exact Mass | 462.29 |
| IUPAC Name | 3-[6-[N-[(4-cyclohexyl-3-ethylphenyl)methoxy]-C-methylcarbonimidoyl]-3,4-dihydro-1H-isoquinolin-2-yl]propanoic acid |
| SMILES | CCc1cc(CON=C(C)c2ccc3c(c2)CCN(CCC(=O)O)C3)ccc1C1CCCCC1 |
| InChI | InChI=1S/C29H38N2O3/c1-3-23-17-22(9-12-28(23)24-7-5-4-6-8-24)20-34-30-21(2)25-10-11-27-19-31(16-14-29(32)33)15-13-26(27)18-25/h9-12,17-18,24H,3-8,13-16,19-20H2,1-2H3,(H,32,33) |
| InChIKey | QZLPAOIXGOKMPX-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 62.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.63 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|