C18H15F2N3 — CID 72792604
3',3'-difluoro-1'-methyl-N-phenylspiro[indole-3,4'-pyrrolidine]-2'-imine (PubChem CID 72792604) has the molecular formula C18H15F2N3 and a molecular weight of 311.34 g/mol. Its IUPAC name is 3',3'-difluoro-1'-methyl-N-phenylspiro[indole-3,4'-pyrrolidine]-2'-imine.
| Compound Name | 3',3'-difluoro-1'-methyl-N-phenylspiro[indole-3,4'-pyrrolidine]-2'-imine |
|---|---|
| PubChem CID | 72792604 |
| Molecular Formula | C18H15F2N3 |
| Molecular Weight | 311.34 g/mol |
| Exact Mass | 311.12 |
| IUPAC Name | 3',3'-difluoro-1'-methyl-N-phenylspiro[indole-3,4'-pyrrolidine]-2'-imine |
| SMILES | CN1CC2(C=Nc3ccccc32)C(F)(F)/C1=N/c1ccccc1 |
| InChI | InChI=1S/C18H15F2N3/c1-23-12-17(11-21-15-10-6-5-9-14(15)17)18(19,20)16(23)22-13-7-3-2-4-8-13/h2-11H,12H2,1H3/b22-16- |
| InChIKey | ZWENFXAPUGXYAS-JWGURIENSA-N |
| XLogP | 3.95 |
| TPSA | 27.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.34 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|