C21H31ClN4O5 — CID 72826461
2-[(5-chloro-2-methoxyphenyl)carbamoylamino]-N-(cyclobutylmethyl)-N-[2-(hydroxyamino)-2-oxoethyl]-3,3-dimethylbutanamide (PubChem CID 72826461) has the molecular formula C21H31ClN4O5 and a molecular weight of 454.96 g/mol. Its IUPAC name is 2-[(5-chloro-2-methoxyphenyl)carbamoylamino]-N-(cyclobutylmethyl)-N-[2-(hydroxyamino)-2-oxoethyl]-3,3-dimethylbutanamide.
| Compound Name | 2-[(5-chloro-2-methoxyphenyl)carbamoylamino]-N-(cyclobutylmethyl)-N-[2-(hydroxyamino)-2-oxoethyl]-3,3-dimethylbutanamide |
|---|---|
| PubChem CID | 72826461 |
| Molecular Formula | C21H31ClN4O5 |
| Molecular Weight | 454.96 g/mol |
| Exact Mass | 454.20 |
| IUPAC Name | 2-[(5-chloro-2-methoxyphenyl)carbamoylamino]-N-(cyclobutylmethyl)-N-[2-(hydroxyamino)-2-oxoethyl]-3,3-dimethylbutanamide |
| SMILES | COc1ccc(Cl)cc1NC(=O)NC(C(=O)N(CC(=O)NO)CC1CCC1)C(C)(C)C |
| InChI | InChI=1S/C21H31ClN4O5/c1-21(2,3)18(19(28)26(12-17(27)25-30)11-13-6-5-7-13)24-20(29)23-15-10-14(22)8-9-16(15)31-4/h8-10,13,18,30H,5-7,11-12H2,1-4H3,(H,25,27)(H2,23,24,29) |
| InChIKey | NVFKPDWYPHRGEL-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 120.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.96 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|