C22H33ClN4O5 — CID 72782718
2-[(5-chloro-2-methoxyphenyl)carbamoylamino]-N-(cyclopentylmethyl)-N-[2-(hydroxyamino)-2-oxoethyl]-3,3-dimethylbutanamide (PubChem CID 72782718) has the molecular formula C22H33ClN4O5 and a molecular weight of 468.98 g/mol. Its IUPAC name is 2-[(5-chloro-2-methoxyphenyl)carbamoylamino]-N-(cyclopentylmethyl)-N-[2-(hydroxyamino)-2-oxoethyl]-3,3-dimethylbutanamide.
| Compound Name | 2-[(5-chloro-2-methoxyphenyl)carbamoylamino]-N-(cyclopentylmethyl)-N-[2-(hydroxyamino)-2-oxoethyl]-3,3-dimethylbutanamide |
|---|---|
| PubChem CID | 72782718 |
| Molecular Formula | C22H33ClN4O5 |
| Molecular Weight | 468.98 g/mol |
| Exact Mass | 468.21 |
| IUPAC Name | 2-[(5-chloro-2-methoxyphenyl)carbamoylamino]-N-(cyclopentylmethyl)-N-[2-(hydroxyamino)-2-oxoethyl]-3,3-dimethylbutanamide |
| SMILES | COc1ccc(Cl)cc1NC(=O)NC(C(=O)N(CC(=O)NO)CC1CCCC1)C(C)(C)C |
| InChI | InChI=1S/C22H33ClN4O5/c1-22(2,3)19(25-21(30)24-16-11-15(23)9-10-17(16)32-4)20(29)27(13-18(28)26-31)12-14-7-5-6-8-14/h9-11,14,19,31H,5-8,12-13H2,1-4H3,(H,26,28)(H2,24,25,30) |
| InChIKey | YQRHKNFCZTXWJA-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 120.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.98 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|