C21H31N5O6 — CID 11408295
(2S)-N-(cyclopentylmethyl)-N-[2-(hydroxyamino)-2-oxoethyl]-3,3-dimethyl-2-[(4-nitrophenyl)carbamoylamino]butanamide (PubChem CID 11408295) has the molecular formula C21H31N5O6 and a molecular weight of 449.51 g/mol. Its IUPAC name is (2S)-N-(cyclopentylmethyl)-N-[2-(hydroxyamino)-2-oxoethyl]-3,3-dimethyl-2-[(4-nitrophenyl)carbamoylamino]butanamide.
| Compound Name | (2S)-N-(cyclopentylmethyl)-N-[2-(hydroxyamino)-2-oxoethyl]-3,3-dimethyl-2-[(4-nitrophenyl)carbamoylamino]butanamide |
|---|---|
| PubChem CID | 11408295 |
| Molecular Formula | C21H31N5O6 |
| Molecular Weight | 449.51 g/mol |
| Exact Mass | 449.23 |
| IUPAC Name | (2S)-N-(cyclopentylmethyl)-N-[2-(hydroxyamino)-2-oxoethyl]-3,3-dimethyl-2-[(4-nitrophenyl)carbamoylamino]butanamide |
| SMILES | CC(C)(C)[C@H](NC(=O)Nc1ccc([N+](=O)[O-])cc1)C(=O)N(CC(=O)NO)CC1CCCC1 |
| InChI | InChI=1S/C21H31N5O6/c1-21(2,3)18(23-20(29)22-15-8-10-16(11-9-15)26(31)32)19(28)25(13-17(27)24-30)12-14-6-4-5-7-14/h8-11,14,18,30H,4-7,12-13H2,1-3H3,(H,24,27)(H2,22,23,29)/t18-/m1/s1 |
| InChIKey | KMQGYYMBFAVVDH-GOSISDBHSA-N |
| XLogP | 2.66 |
| TPSA | 153.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.51 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|